Products 7250-53-5
CAS 7250-53-5 appears in our catalog under these names: Quinoline–5–carboxylic, Quinoline-5-carboxylic acid, 5-Quinolinecarboxylic acid 98%, 5-Quinolinecarboxylic acid, 98.23%, Quinoline-5-carboxylic acid, 95%. Offered by: GLPBio, Biosynth, Ambeed, MedChemExpress, Combi-blocks. Available pack sizes: 10g, 5g, 0,25g, 0,5g, 1g, 2g, 25g, 100g.
Quinoline-5-carboxylic acid (CAS 7250-53-5) is a chemical compound with the molecular formula C10H7NO2 and a molecular weight of 173.17 g/mol. IUPAC name: quinoline-5-carboxylic acid. InChIKey: RAYMXZBXQCGRGX-UHFFFAOYSA-N.
| Molecular formula | C10H7NO2 |
|---|---|
| Molecular weight | 173.17 g/mol |
| IUPAC name | quinoline-5-carboxylic acid |
| InChIKey | RAYMXZBXQCGRGX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C=CC=NC2=C1)C(=O)O |
Computed by PubChem (NCBI)