CAS 872577-50-9 appears in our catalog under these names: 3-Cyano-4-hydroxy-quinoline-6-carboxylic acid ethyl ester, 95%, 3-Cyano-1,4-dihydro-4-oxo-6-quinolinecarboxylic acid ethyl ester, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
Ethyl 3-cyano-4-oxo-1H-quinoline-6-carboxylate (CAS 872577-50-9) is a chemical compound with the molecular formula C13H10N2O3 and a molecular weight of 242.23 g/mol. IUPAC name: ethyl 3-cyano-4-oxo-1H-quinoline-6-carboxylate. InChIKey: ILHUVMOSKDCTJO-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O3 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | ethyl 3-cyano-4-oxo-1H-quinoline-6-carboxylate |
| InChIKey | ILHUVMOSKDCTJO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=C1)NC=C(C2=O)C#N |
Computed by PubChem (NCBI)