CAS 728024-40-6 is the registry number for 5-(3-Chloro-benzyl)-2H-tetrazole. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
5-[(3-chlorophenyl)methyl]-2H-tetrazole (CAS 728024-40-6) is a chemical compound with the molecular formula C8H7ClN4 and a molecular weight of 194.62 g/mol. IUPAC name: 5-[(3-chlorophenyl)methyl]-2H-tetrazole. InChIKey: VIWWDINFPKJOQZ-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN4 |
|---|---|
| Molecular weight | 194.62 g/mol |
| IUPAC name | 5-[(3-chlorophenyl)methyl]-2H-tetrazole |
| InChIKey | VIWWDINFPKJOQZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)CC2=NNN=N2 |
Computed by PubChem (NCBI)