Products 72899-92-4
CAS 72899-92-4 appears in our catalog under these names: 1–(4–Carboxyphenyl)–1H–pyrazole–3–carboxylicacid, 1-(4-Carboxyphenyl)-1H-pyrazole-3-carboxylic acid, 98%, 1H-Pyrazole-3-carboxylic acid, 1-(4-carboxyphenyl)-, 97%, 1-(4-carboxyphenyl)-1H-pyrazole-3-carboxylic acid, 97%. Offered by: GLPBio, Ambeed, BLDpharm, Fluorochem, Chemat. Available pack sizes: 1g, 250mg, 100mg, 5g.
1-(4-carboxyphenyl)pyrazole-3-carboxylic acid (CAS 72899-92-4) is a chemical compound with the molecular formula C11H8N2O4 and a molecular weight of 232.19 g/mol. IUPAC name: 1-(4-carboxyphenyl)pyrazole-3-carboxylic acid. InChIKey: PAUMWDAXVWCUOZ-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O4 |
|---|---|
| Molecular weight | 232.19 g/mol |
| IUPAC name | 1-(4-carboxyphenyl)pyrazole-3-carboxylic acid |
| InChIKey | PAUMWDAXVWCUOZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)N2C=CC(=N2)C(=O)O |
Computed by PubChem (NCBI)