CAS 72985-49-0 appears in our catalog under these names: 7-Methoxy-4-methyl-2,3-dihydro-1H-indole-2,3-dione, 95%, 7-Methoxy-4-methyl-2,3-dihydro-1H-indole-2,3-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
7-methoxy-4-methyl-1H-indole-2,3-dione (CAS 72985-49-0) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. IUPAC name: 7-methoxy-4-methyl-1H-indole-2,3-dione. InChIKey: FGZDNNJCFOKWBL-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | 7-methoxy-4-methyl-1H-indole-2,3-dione |
| InChIKey | FGZDNNJCFOKWBL-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=C(C=C1)OC)NC(=O)C2=O |
Computed by PubChem (NCBI)