Products 73016-10-1
CAS 73016-10-1 appears in our catalog under these names: 9，10–Anthracenedicarboxylic acid， dimethyl ester, Dimethyl anthracene-9,10-dicarboxylate, 97%, 97%, Dimethyl anthracene-9,10-dicarboxylate, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
Dimethyl anthracene-9,10-dicarboxylate (CAS 73016-10-1) is a chemical compound with the molecular formula C18H14O4 and a molecular weight of 294.3 g/mol. IUPAC name: dimethyl anthracene-9,10-dicarboxylate. InChIKey: RCNIABNGCIWEPC-UHFFFAOYSA-N.
| Molecular formula | C18H14O4 |
|---|---|
| Molecular weight | 294.3 g/mol |
| IUPAC name | dimethyl anthracene-9,10-dicarboxylate |
| InChIKey | RCNIABNGCIWEPC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C2C=CC=CC2=C(C3=CC=CC=C31)C(=O)OC |
Computed by PubChem (NCBI)