CAS 73448-02-9 appears in our catalog under these names: 1,2-Diamino-4,5-ethylenedioxybenzene, dihydrochloride, 98%, 1,2-Diamino-4,5-ethylenedioxybenzene, Dihydrochloride, 1,2-Diamino-3,4-ethylenedioxybenzene dih, ydrochloride, 25 mg, 1,2-Diamino-3,4-ethylenedioxybenzene dih, ydrochloride, 50 mg, 1,2-Diamino-3,4-ethylenedioxybenzene dih, ydrochloride, 100 mg. Offered by: Chemat Brand, TRC, Roth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 250mg, 500mg.
2,3-dihydro-1,4-benzodioxine-6,7-diamine;dihydrochloride (CAS 73448-02-9) is a chemical compound with the molecular formula C8H12Cl2N2O2 and a molecular weight of 239.10 g/mol. IUPAC name: 2,3-dihydro-1,4-benzodioxine-6,7-diamine;dihydrochloride. InChIKey: XXHGNNYLGJCVEG-UHFFFAOYSA-N.
| Molecular formula | C8H12Cl2N2O2 |
|---|---|
| Molecular weight | 239.10 g/mol |
| IUPAC name | 2,3-dihydro-1,4-benzodioxine-6,7-diamine;dihydrochloride |
| InChIKey | XXHGNNYLGJCVEG-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=C(C(=C2)N)N.Cl.Cl |
Computed by PubChem (NCBI)