Products 73473-41-3

CAS 73473-41-3 is the registry number for 2-Methyl-D-norleucine hydrochloride, >95%, >95%. Offered by: Chemat. Available pack sizes: 100mg, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

(2R)-2-amino-2-methylhexanoic acid;hydrochloride (CAS 73473-41-3) is a chemical compound with the molecular formula C7H16ClNO2 and a molecular weight of 181.66 g/mol. IUPAC name: (2R)-2-amino-2-methylhexanoic acid;hydrochloride. InChIKey: DJYRKWUMFWVEQP-OGFXRTJISA-N.

Identity
Molecular formulaC7H16ClNO2
Molecular weight181.66 g/mol
IUPAC name(2R)-2-amino-2-methylhexanoic acid;hydrochloride
InChIKeyDJYRKWUMFWVEQP-OGFXRTJISA-N
SMILESCCCC[C@](C)(C(=O)O)N.Cl

Computed by PubChem (NCBI)