CAS 7400-62-6 is the registry number for 2-(Naphthalen-2-yl)-2-oxoacetaldehyde hydrate, 95+%. Offered by: AmBeed. Available pack sizes: 25g.
2-naphthalen-2-yl-2-oxoacetaldehyde;hydrate (CAS 7400-62-6) is a chemical compound with the molecular formula C12H10O3 and a molecular weight of 202.21 g/mol. IUPAC name: 2-naphthalen-2-yl-2-oxoacetaldehyde;hydrate. InChIKey: VDEXQTPNFMMGEQ-UHFFFAOYSA-N.
| Molecular formula | C12H10O3 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | 2-naphthalen-2-yl-2-oxoacetaldehyde;hydrate |
| InChIKey | VDEXQTPNFMMGEQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C(=O)C=O.O |
Computed by PubChem (NCBI)