CAS 741698-90-8 is the registry number for 2-Acetyl-4-bromobenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-acetyl-4-bromobenzoic acid (CAS 741698-90-8) is a chemical compound with the molecular formula C9H7BrO3 and a molecular weight of 243.05 g/mol. IUPAC name: 2-acetyl-4-bromobenzoic acid. InChIKey: ZWNDIRMSBLVKTQ-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO3 |
|---|---|
| Molecular weight | 243.05 g/mol |
| IUPAC name | 2-acetyl-4-bromobenzoic acid |
| InChIKey | ZWNDIRMSBLVKTQ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=CC(=C1)Br)C(=O)O |
Computed by PubChem (NCBI)