Products 741698-90-8

CAS 741698-90-8 is the registry number for 2-Acetyl-4-bromobenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-acetyl-4-bromobenzoic acid (CAS 741698-90-8) is a chemical compound with the molecular formula C9H7BrO3 and a molecular weight of 243.05 g/mol. IUPAC name: 2-acetyl-4-bromobenzoic acid. InChIKey: ZWNDIRMSBLVKTQ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7BrO3
Molecular weight243.05 g/mol
IUPAC name2-acetyl-4-bromobenzoic acid
InChIKeyZWNDIRMSBLVKTQ-UHFFFAOYSA-N
SMILESCC(=O)C1=C(C=CC(=C1)Br)C(=O)O

Computed by PubChem (NCBI)