CAS 74209-34-0 appears in our catalog under these names: 3-Bromo-7-nitroindazole, >95% (HPLC), 3-Bromo-7-nitroindazole, 3–Bromo–7–nitroindazole, 3-Bromo-7-nitroindazole, 98+% , 3-Bromo-7-nitroindazole 98%. Offered by: TRC, TargetMol, GLPBio, Thermo Scientific (Alfa Aesar), Ambeed. Available pack sizes: 50mg, 25mg, 100mg, 200mg, 500mg, 10mg, 1g, 5g.
3-bromo-7-nitro-2H-indazole (CAS 74209-34-0) is a chemical compound with the molecular formula C7H4BrN3O2 and a molecular weight of 242.03 g/mol. IUPAC name: 3-bromo-7-nitro-2H-indazole. InChIKey: NFSTZPMYAZRZPC-UHFFFAOYSA-N.
| Molecular formula | C7H4BrN3O2 |
|---|---|
| Molecular weight | 242.03 g/mol |
| IUPAC name | 3-bromo-7-nitro-2H-indazole |
| InChIKey | NFSTZPMYAZRZPC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(NN=C2C(=C1)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)