CAS 74341-77-8 appears in our catalog under these names: N-Propyl-3,4-methylenedioxyamphetamine Hydrochloride (3,4-MDPA HCl), N-Propyl-3,4-methylenedioxyamphetamine Hydrochloride (3,4-MDPA HCl) 1.0 mg/ml in Methanol (as free base), 3,4–MDPA (hydrochloride), 3,4-MDPA (hydrochloride). Offered by: LoGiCal, GLPBio, MedChemExpress. Available pack sizes: 10mg, 1ml, 5mg, 50mg, 10 mg, 50 mg, 5 mg, 25 mg.
1-(1,3-benzodioxol-5-yl)-N-propylpropan-2-amine;hydrochloride (CAS 74341-77-8) is a chemical compound with the molecular formula C13H20ClNO2 and a molecular weight of 257.75 g/mol. IUPAC name: 1-(1,3-benzodioxol-5-yl)-N-propylpropan-2-amine;hydrochloride. InChIKey: WAXHXZWOUQTVQZ-UHFFFAOYSA-N.
| Molecular formula | C13H20ClNO2 |
|---|---|
| Molecular weight | 257.75 g/mol |
| IUPAC name | 1-(1,3-benzodioxol-5-yl)-N-propylpropan-2-amine;hydrochloride |
| InChIKey | WAXHXZWOUQTVQZ-UHFFFAOYSA-N |
| SMILES | CCCNC(C)CC1=CC2=C(C=C1)OCO2.Cl |
Computed by PubChem (NCBI)