Products 743440-57-5
CAS 743440-57-5 is the registry number for 2-Cyano-3-(2,5-dimethyl-1-(naphthalen-1-yl)-1H-pyrrol-3-yl)prop-2-enoic acid. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
(E)-2-cyano-3-(2,5-dimethyl-1-naphthalen-1-ylpyrrol-3-yl)prop-2-enoic acid (CAS 743440-57-5) is a chemical compound with the molecular formula C20H16N2O2 and a molecular weight of 316.4 g/mol. IUPAC name: (E)-2-cyano-3-(2,5-dimethyl-1-naphthalen-1-ylpyrrol-3-yl)prop-2-enoic acid. InChIKey: WOQDKUQIEVTMTC-GZTJUZNOSA-N.
| Molecular formula | C20H16N2O2 |
|---|---|
| Molecular weight | 316.4 g/mol |
| IUPAC name | (E)-2-cyano-3-(2,5-dimethyl-1-naphthalen-1-ylpyrrol-3-yl)prop-2-enoic acid |
| InChIKey | WOQDKUQIEVTMTC-GZTJUZNOSA-N |
| SMILES | CC1=CC(=C(N1C2=CC=CC3=CC=CC=C32)C)/C=C(\C#N)/C(=O)O |
Computed by PubChem (NCBI)