CAS 744152-38-3 is the registry number for 4-Methyl-2-(2-methylthiazol-4-yl)phenol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-methyl-2-(2-methyl-1,3-thiazol-4-yl)phenol (CAS 744152-38-3) is a chemical compound with the molecular formula C11H11NOS and a molecular weight of 205.28 g/mol. IUPAC name: 4-methyl-2-(2-methyl-1,3-thiazol-4-yl)phenol. InChIKey: GNLUONSQMQRANA-UHFFFAOYSA-N.
| Molecular formula | C11H11NOS |
|---|---|
| Molecular weight | 205.28 g/mol |
| IUPAC name | 4-methyl-2-(2-methyl-1,3-thiazol-4-yl)phenol |
| InChIKey | GNLUONSQMQRANA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)O)C2=CSC(=N2)C |
Computed by PubChem (NCBI)