Products 748150-53-0
CAS 748150-53-0 is the registry number for 4-Chloro-5-hydroxy-2,3-dihydro-1H-inden-1-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-chloro-5-hydroxy-2,3-dihydroinden-1-one (CAS 748150-53-0) is a chemical compound with the molecular formula C9H7ClO2 and a molecular weight of 182.60 g/mol. IUPAC name: 4-chloro-5-hydroxy-2,3-dihydroinden-1-one. InChIKey: IWUSSOKHQFNNAC-UHFFFAOYSA-N.
| Molecular formula | C9H7ClO2 |
|---|---|
| Molecular weight | 182.60 g/mol |
| IUPAC name | 4-chloro-5-hydroxy-2,3-dihydroinden-1-one |
| InChIKey | IWUSSOKHQFNNAC-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C1C(=C(C=C2)O)Cl |
Computed by PubChem (NCBI)