Products 749240-54-8
CAS 749240-54-8 is the registry number for 5-Fluoro-6-methylindoline-2,3-dione, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
5-fluoro-6-methyl-1H-indole-2,3-dione (CAS 749240-54-8) is a chemical compound with the molecular formula C9H6FNO2 and a molecular weight of 179.15 g/mol. IUPAC name: 5-fluoro-6-methyl-1H-indole-2,3-dione. InChIKey: QCPNTAQCZZNWQK-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO2 |
|---|---|
| Molecular weight | 179.15 g/mol |
| IUPAC name | 5-fluoro-6-methyl-1H-indole-2,3-dione |
| InChIKey | QCPNTAQCZZNWQK-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1F)C(=O)C(=O)N2 |
Computed by PubChem (NCBI)
Synonyms:
5-Fluoro-6-methyl isatin, 5-Fluoro-6-methylisatin, 5-Fluoro-6-methylindoline-2,3-dione, 5-fluoro-6-methyl-1H-Indole-2,3-dione, 5-fluoro-3-hydroxy-6-methyl-2H-indol-2-one, 1H-Indole-2,3-dione, 5-fluoro-6-methyl-, 5-fluoro-6-methyl-indoline-2,3-dione, 5-Fluoro-6-Methyl Isatin ISO 90012015 REACH