CAS 749240-55-9 is the registry number for 6-Fluoro-5-methylIsatin, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-fluoro-5-methyl-1H-indole-2,3-dione (CAS 749240-55-9) is a chemical compound with the molecular formula C9H6FNO2 and a molecular weight of 179.15 g/mol. IUPAC name: 6-fluoro-5-methyl-1H-indole-2,3-dione. InChIKey: OPLAHVRYRKSZLK-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO2 |
|---|---|
| Molecular weight | 179.15 g/mol |
| IUPAC name | 6-fluoro-5-methyl-1H-indole-2,3-dione |
| InChIKey | OPLAHVRYRKSZLK-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1F)NC(=O)C2=O |
Computed by PubChem (NCBI)