Products 75020-50-7
CAS 75020-50-7 is the registry number for ethyl 1-benzyl-5-chloro-triazole-4-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
Ethyl 1-benzyl-5-chlorotriazole-4-carboxylate (CAS 75020-50-7) is a chemical compound with the molecular formula C12H12ClN3O2 and a molecular weight of 265.69 g/mol. IUPAC name: ethyl 1-benzyl-5-chlorotriazole-4-carboxylate. InChIKey: BGQSCEFNNAYYHS-UHFFFAOYSA-N.
| Molecular formula | C12H12ClN3O2 |
|---|---|
| Molecular weight | 265.69 g/mol |
| IUPAC name | ethyl 1-benzyl-5-chlorotriazole-4-carboxylate |
| InChIKey | BGQSCEFNNAYYHS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(N=N1)CC2=CC=CC=C2)Cl |
Computed by PubChem (NCBI)