Products 75446-59-2
CAS 75446-59-2 is the registry number for 2-[(4-phenylphenyl)formamido]acetic acid, 95%. Offered by: Fluorochem. Available pack sizes: 250mg.
2-[(4-phenylbenzoyl)amino]acetic acid (CAS 75446-59-2) is a chemical compound with the molecular formula C15H13NO3 and a molecular weight of 255.27 g/mol. IUPAC name: 2-[(4-phenylbenzoyl)amino]acetic acid. InChIKey: MYJXSDFBYVYUCD-UHFFFAOYSA-N.
| Molecular formula | C15H13NO3 |
|---|---|
| Molecular weight | 255.27 g/mol |
| IUPAC name | 2-[(4-phenylbenzoyl)amino]acetic acid |
| InChIKey | MYJXSDFBYVYUCD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)NCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-[(4-phenylphenyl)formamido]acetic acid, 2-((4-Phenylphenyl)formamido)acetic acid, [(biphenyl-4-carbonyl)-amino]-acetic acid, 2-[(4-phenylbenzoyl)amino]acetic acid, 2-([1,1'-Biphenyl]-4-ylcarboxamido)acetic acid, Oprea1_460151, MYJXSDFBYVYUCD-UHFFFAOYSA-N, 2-(4-Biphenylylcarboxamido)acetic Acid, [(Biphenyl-4-carbonyl)amino]acetic acid, N-([1,1'-Biphenyl]-4-carbonyl)glycine