Products 75680-91-0
CAS 75680-91-0 appears in our catalog under these names: Ethyl 4–(4–chlorophenyl)thiazole–2–carboxylate, Ethyl 4-(4-chlorophenyl)thiazole-2-carboxylate, 95%, 95%, 4-(4-CHLORO-PHENYL)-THIAZOLE-2-CARBOXYLIC ACID ETHYL ESTER, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
Ethyl 4-(4-chlorophenyl)-1,3-thiazole-2-carboxylate (CAS 75680-91-0) is a chemical compound with the molecular formula C12H10ClNO2S and a molecular weight of 267.73 g/mol. IUPAC name: ethyl 4-(4-chlorophenyl)-1,3-thiazole-2-carboxylate. InChIKey: RCSJMEGGOPRTDG-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO2S |
|---|---|
| Molecular weight | 267.73 g/mol |
| IUPAC name | ethyl 4-(4-chlorophenyl)-1,3-thiazole-2-carboxylate |
| InChIKey | RCSJMEGGOPRTDG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC(=CS1)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)