CAS 75768-66-0 appears in our catalog under these names: N-Benzyl-L-tyrosine, >95% (HPLC), (S)-2-(Benzylamino)-3-(4-hydroxyphenyl)propanoic acid. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 1g, 50mg, 50 mg, 100 mg, 1 g.
(2S)-2-(benzylamino)-3-(4-hydroxyphenyl)propanoic acid (CAS 75768-66-0) is a chemical compound with the molecular formula C16H17NO3 and a molecular weight of 271.31 g/mol. IUPAC name: (2S)-2-(benzylamino)-3-(4-hydroxyphenyl)propanoic acid. InChIKey: WUTPXBXSEMJIDW-HNNXBMFYSA-N.
| Molecular formula | C16H17NO3 |
|---|---|
| Molecular weight | 271.31 g/mol |
| IUPAC name | (2S)-2-(benzylamino)-3-(4-hydroxyphenyl)propanoic acid |
| InChIKey | WUTPXBXSEMJIDW-HNNXBMFYSA-N |
| SMILES | C1=CC=C(C=C1)CN[C@@H](CC2=CC=C(C=C2)O)C(=O)O |
Computed by PubChem (NCBI)