CAS 75898-47-4 appears in our catalog under these names: H–DL–Phe–OtBu·HCl, H-DL-Phe-OtBu.HCl, 95%, 95%, H-DL-Phe-OtBu.HCl, 98.0%, tert-Butyl 2-amino-3-phenylpropanoate hydrochloride, 97%. Offered by: GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 5g, 1g, 10g, 25g, 100g, 25 g, 10 g, 500 g.
Tert-butyl 2-amino-3-phenylpropanoate;hydrochloride (CAS 75898-47-4) is a chemical compound with the molecular formula C13H20ClNO2 and a molecular weight of 257.75 g/mol. IUPAC name: tert-butyl 2-amino-3-phenylpropanoate;hydrochloride. InChIKey: FDMCEXDXULPJPG-UHFFFAOYSA-N.
| Molecular formula | C13H20ClNO2 |
|---|---|
| Molecular weight | 257.75 g/mol |
| IUPAC name | tert-butyl 2-amino-3-phenylpropanoate;hydrochloride |
| InChIKey | FDMCEXDXULPJPG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C(CC1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)