CAS 76089-01-5 is the registry number for 2,3-Dichloroquinoxalin-6-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2,3-dichloroquinoxalin-6-amine (CAS 76089-01-5) is a chemical compound with the molecular formula C8H5Cl2N3 and a molecular weight of 214.05 g/mol. IUPAC name: 2,3-dichloroquinoxalin-6-amine. InChIKey: YCLUGYOTBXWZAF-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2N3 |
|---|---|
| Molecular weight | 214.05 g/mol |
| IUPAC name | 2,3-dichloroquinoxalin-6-amine |
| InChIKey | YCLUGYOTBXWZAF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1N)N=C(C(=N2)Cl)Cl |
Computed by PubChem (NCBI)