CAS 76549-76-3 is the registry number for 1,2-O-Isopropylidene-β-D-fructofuranose. Offered by: Chemat. Available pack sizes: 1g, 250mg, 2g, 500mg.
(5S,7R,8S,9S)-7-(hydroxymethyl)-2,2-dimethyl-1,3,6-trioxaspiro[4.4]nonane-8,9-diol (CAS 76549-76-3) is a chemical compound with the molecular formula C9H16O6 and a molecular weight of 220.22 g/mol. IUPAC name: (5S,7R,8S,9S)-7-(hydroxymethyl)-2,2-dimethyl-1,3,6-trioxaspiro[4.4]nonane-8,9-diol. InChIKey: FRQMMDYYPZUBHX-JAKMQLQISA-N.
| Molecular formula | C9H16O6 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | (5S,7R,8S,9S)-7-(hydroxymethyl)-2,2-dimethyl-1,3,6-trioxaspiro[4.4]nonane-8,9-diol |
| InChIKey | FRQMMDYYPZUBHX-JAKMQLQISA-N |
| SMILES | CC1(OC[C@]2(O1)[C@H]([C@@H]([C@H](O2)CO)O)O)C |
Computed by PubChem (NCBI)