CAS 7698-98-8 appears in our catalog under these names: 3-(4-Chlorophenoxy)-2-hydroxypropanoic acid, 98%, Chlorphenesin Impurity 7, 3-(p-Chlorophenoxy)lactic Acid, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg, 500mg, 50mg.
3-(4-chlorophenoxy)-2-hydroxypropanoic acid (CAS 7698-98-8) is a chemical compound with the molecular formula C9H9ClO4 and a molecular weight of 216.62 g/mol. IUPAC name: 3-(4-chlorophenoxy)-2-hydroxypropanoic acid. InChIKey: HYNAIYBUUSJFKL-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO4 |
|---|---|
| Molecular weight | 216.62 g/mol |
| IUPAC name | 3-(4-chlorophenoxy)-2-hydroxypropanoic acid |
| InChIKey | HYNAIYBUUSJFKL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OCC(C(=O)O)O)Cl |
Computed by PubChem (NCBI)