CAS 773872-29-0 is the registry number for 2'-(Hydroxymethyl)biphenyl-3-carboxylic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-[2-(hydroxymethyl)phenyl]benzoic acid (CAS 773872-29-0) is a chemical compound with the molecular formula C14H12O3 and a molecular weight of 228.24 g/mol. IUPAC name: 3-[2-(hydroxymethyl)phenyl]benzoic acid. InChIKey: LIUSEGRHRKNETK-UHFFFAOYSA-N.
| Molecular formula | C14H12O3 |
|---|---|
| Molecular weight | 228.24 g/mol |
| IUPAC name | 3-[2-(hydroxymethyl)phenyl]benzoic acid |
| InChIKey | LIUSEGRHRKNETK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CO)C2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)