Products 773872-69-8
CAS 773872-69-8 appears in our catalog under these names: 4'-(Hydroxymethyl)biphenyl-3-carboxylic acid, 97%, 4'-(Hydroxymethyl)[1,1'-biphenyl]-3-carboxylic acid, 97%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g.
3-[4-(hydroxymethyl)phenyl]benzoic acid (CAS 773872-69-8) is a chemical compound with the molecular formula C14H12O3 and a molecular weight of 228.24 g/mol. IUPAC name: 3-[4-(hydroxymethyl)phenyl]benzoic acid. InChIKey: ZOCJZYHNQJDOGC-UHFFFAOYSA-N.
| Molecular formula | C14H12O3 |
|---|---|
| Molecular weight | 228.24 g/mol |
| IUPAC name | 3-[4-(hydroxymethyl)phenyl]benzoic acid |
| InChIKey | ZOCJZYHNQJDOGC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C2=CC=C(C=C2)CO |
Computed by PubChem (NCBI)