Products 773874-16-1
CAS 773874-16-1 appears in our catalog under these names: Methyl 2,4-difluoro-6-hydroxybenzoate, 98%, Methyl 2，4–difluoro–6–hydroxybenzoate, Methyl 2,4-difluoro-6-hydroxybenzoate 95%, Benzoic acid, 2,4-difluoro-6-hydroxy-, methyl ester, 95%, 95%, Methyl 2,4-difluoro-6-hydroxybenzoate, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 25g, 250mg.
Methyl 2,4-difluoro-6-hydroxybenzoate (CAS 773874-16-1) is a chemical compound with the molecular formula C8H6F2O3 and a molecular weight of 188.13 g/mol. IUPAC name: methyl 2,4-difluoro-6-hydroxybenzoate. InChIKey: HBQNRBLKVLSSMK-UHFFFAOYSA-N.
| Molecular formula | C8H6F2O3 |
|---|---|
| Molecular weight | 188.13 g/mol |
| IUPAC name | methyl 2,4-difluoro-6-hydroxybenzoate |
| InChIKey | HBQNRBLKVLSSMK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1F)F)O |
Computed by PubChem (NCBI)