CAS 773874-59-2 is the registry number for Methyl 2-chloro-8-methylquinoline-3-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-chloro-8-methylquinoline-3-carboxylate (CAS 773874-59-2) is a chemical compound with the molecular formula C12H10ClNO2 and a molecular weight of 235.66 g/mol. IUPAC name: methyl 2-chloro-8-methylquinoline-3-carboxylate. InChIKey: IORDVUFIGBKQKG-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO2 |
|---|---|
| Molecular weight | 235.66 g/mol |
| IUPAC name | methyl 2-chloro-8-methylquinoline-3-carboxylate |
| InChIKey | IORDVUFIGBKQKG-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C=C(C(=N2)Cl)C(=O)OC |
Computed by PubChem (NCBI)