CAS 77388-91-1 appears in our catalog under these names: (2R,3R,4S,5R,6R)–4–(allyloxy)–6–(hydroxymethyl)tetrahydro–2H–pyran–2,3,5–triol, 3-O-Allyl-β-D-glucopyranose. Offered by: GLPBio, Chemat. Available pack sizes: 10g, 25g, 5g, 50g.
(2R,3R,4S,5R,6R)-6-(hydroxymethyl)-4-prop-2-enoxyoxane-2,3,5-triol (CAS 77388-91-1) is a chemical compound with the molecular formula C9H16O6 and a molecular weight of 220.22 g/mol. IUPAC name: (2R,3R,4S,5R,6R)-6-(hydroxymethyl)-4-prop-2-enoxyoxane-2,3,5-triol. InChIKey: VDMLDFBLAQXIKZ-GOFVFXDOSA-N.
| Molecular formula | C9H16O6 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | (2R,3R,4S,5R,6R)-6-(hydroxymethyl)-4-prop-2-enoxyoxane-2,3,5-triol |
| InChIKey | VDMLDFBLAQXIKZ-GOFVFXDOSA-N |
| SMILES | C=CCO[C@H]1[C@@H]([C@H](O[C@H]([C@@H]1O)O)CO)O |
Computed by PubChem (NCBI)