CAS 77395-10-9 appears in our catalog under these names: 5-Bromo-7-methyl-1h-indole-2,3-dione, 95%, 5-Bromo-7-methyl-1H-indole-2,3-dione, >95% (HPLC), 5–Bromo–7–methylindoline–2,3–dione, 5-Bromo-7-methylindoline-2,3-dione 95%, 5-Bromo-7-methylindoline-2,3-dione, 95%, 95%. Offered by: Combi-blocks, TRC, GLPBio, Ambeed, Chemat. Available pack sizes: 5g, 250mg, 1g, 100mg, 500mg, 25g, 10g.
5-bromo-7-methyl-1H-indole-2,3-dione (CAS 77395-10-9) is a chemical compound with the molecular formula C9H6BrNO2 and a molecular weight of 240.05 g/mol. IUPAC name: 5-bromo-7-methyl-1H-indole-2,3-dione. InChIKey: NPRAKNSGKOICIE-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO2 |
|---|---|
| Molecular weight | 240.05 g/mol |
| IUPAC name | 5-bromo-7-methyl-1H-indole-2,3-dione |
| InChIKey | NPRAKNSGKOICIE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1NC(=O)C2=O)Br |
Computed by PubChem (NCBI)