Products 77629-52-8
CAS 77629-52-8 appears in our catalog under these names: Ethyl 2,4-dichloro-5,6-dimethylnicotinate, 97%, 3-Pyridinecarboxylic acid, 2,4-dichloro-5,6-dimethyl-, ethyl ester, 97%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
Ethyl 2,4-dichloro-5,6-dimethylpyridine-3-carboxylate (CAS 77629-52-8) is a chemical compound with the molecular formula C10H11Cl2NO2 and a molecular weight of 248.10 g/mol. IUPAC name: ethyl 2,4-dichloro-5,6-dimethylpyridine-3-carboxylate. InChIKey: KJFHEXAQPDSFKJ-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl2NO2 |
|---|---|
| Molecular weight | 248.10 g/mol |
| IUPAC name | ethyl 2,4-dichloro-5,6-dimethylpyridine-3-carboxylate |
| InChIKey | KJFHEXAQPDSFKJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=C(N=C1Cl)C)C)Cl |
Computed by PubChem (NCBI)