CAS 78148-37-5 is the registry number for 3-O-Methyl-L-DOPA Methyl Ester. Offered by: TRC. Available pack sizes: 250mg, 25mg.
Methyl (2S)-2-amino-3-(4-hydroxy-3-methoxyphenyl)propanoate (CAS 78148-37-5) is a chemical compound with the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. IUPAC name: methyl (2S)-2-amino-3-(4-hydroxy-3-methoxyphenyl)propanoate. InChIKey: OSGOAQVFZXVPBZ-QMMMGPOBSA-N.
| Molecular formula | C11H15NO4 |
|---|---|
| Molecular weight | 225.24 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-(4-hydroxy-3-methoxyphenyl)propanoate |
| InChIKey | OSGOAQVFZXVPBZ-QMMMGPOBSA-N |
| SMILES | COC1=C(C=CC(=C1)C[C@@H](C(=O)OC)N)O |
Computed by PubChem (NCBI)