CAS 79242-76-5 appears in our catalog under these names: 2–(1H–Pyrrol–1–yl)thiophene–3–carboxylic acid, 2-(1H-Pyrrol-1-yl)thiophene-3-carboxylic acid, 97%, 97%, 2-(1H-Pyrrol-1-yl)thiophene-3-carboxylic acid, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-pyrrol-1-ylthiophene-3-carboxylic acid (CAS 79242-76-5) is a chemical compound with the molecular formula C9H7NO2S and a molecular weight of 193.22 g/mol. IUPAC name: 2-pyrrol-1-ylthiophene-3-carboxylic acid. InChIKey: HGVFZWBIJVXWGG-UHFFFAOYSA-N.
| Molecular formula | C9H7NO2S |
|---|---|
| Molecular weight | 193.22 g/mol |
| IUPAC name | 2-pyrrol-1-ylthiophene-3-carboxylic acid |
| InChIKey | HGVFZWBIJVXWGG-UHFFFAOYSA-N |
| SMILES | C1=CN(C=C1)C2=C(C=CS2)C(=O)O |
Computed by PubChem (NCBI)