CAS 792969-85-8 is the registry number for Sildenafil Impurity 152. Offered by: Chemat Brand. Available pack sizes: on request.
1-methyl-4-nitro-3-propan-2-ylpyrazole-5-carboxamide (CAS 792969-85-8) is a chemical compound with the molecular formula C8H12N4O3 and a molecular weight of 212.21 g/mol. IUPAC name: 1-methyl-4-nitro-3-propan-2-ylpyrazole-5-carboxamide. InChIKey: RYIJOZXADOHAGO-UHFFFAOYSA-N.
| Molecular formula | C8H12N4O3 |
|---|---|
| Molecular weight | 212.21 g/mol |
| IUPAC name | 1-methyl-4-nitro-3-propan-2-ylpyrazole-5-carboxamide |
| InChIKey | RYIJOZXADOHAGO-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NN(C(=C1[N+](=O)[O-])C(=O)N)C |
Computed by PubChem (NCBI)