CAS 79478-16-3 appears in our catalog under these names: 4-Phenoxyphenylglyoxylic Acid, 2-Oxo-2-(4-phenoxyphenyl)acetic acid. Offered by: TRC, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
2-oxo-2-(4-phenoxyphenyl)acetic acid (CAS 79478-16-3) is a chemical compound with the molecular formula C14H10O4 and a molecular weight of 242.23 g/mol. IUPAC name: 2-oxo-2-(4-phenoxyphenyl)acetic acid. InChIKey: PGZNZMXCYFYRSS-UHFFFAOYSA-N.
| Molecular formula | C14H10O4 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | 2-oxo-2-(4-phenoxyphenyl)acetic acid |
| InChIKey | PGZNZMXCYFYRSS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)C(=O)C(=O)O |
Computed by PubChem (NCBI)