Products 799814-32-7
CAS 799814-32-7 appears in our catalog under these names: 2-(Difluoromethyl)benzoic acid, 98%, 2–(Difluoromethyl)benzoic acid, 2-(Difluoromethyl)benzoic acid, 2-(Difluoromethyl)benzoic acid 98%, 2-(Difluoromethyl)benzoic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 25g, 1g, 100mg, 250mg, 10g.
2-(difluoromethyl)benzoic acid (CAS 799814-32-7) is a chemical compound with the molecular formula C8H6F2O2 and a molecular weight of 172.13 g/mol. IUPAC name: 2-(difluoromethyl)benzoic acid. InChIKey: CCADJZMMYROPCV-UHFFFAOYSA-N.
| Molecular formula | C8H6F2O2 |
|---|---|
| Molecular weight | 172.13 g/mol |
| IUPAC name | 2-(difluoromethyl)benzoic acid |
| InChIKey | CCADJZMMYROPCV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(F)F)C(=O)O |
Computed by PubChem (NCBI)