Products 79987-78-3
CAS 79987-78-3 appears in our catalog under these names: 1-Benzyl-3-(3-hydroxyphenyl)piperidine-2,6-dione, 98%, 1-benzyl-3-(3-hydroxyphenyl)piperidine-2,6-dione, 98%, 98%, CRBN ligand-210. Offered by: Fluorochem, Chemat, MedChemExpress. Available pack sizes: 100mg, 250mg, 50 mg, 25 mg, 100 mg.
1-benzyl-3-(3-hydroxyphenyl)piperidine-2,6-dione (CAS 79987-78-3) is a chemical compound with the molecular formula C18H17NO3 and a molecular weight of 295.3 g/mol. IUPAC name: 1-benzyl-3-(3-hydroxyphenyl)piperidine-2,6-dione. InChIKey: VDQYMEUOWOWQNG-UHFFFAOYSA-N.
| Molecular formula | C18H17NO3 |
|---|---|
| Molecular weight | 295.3 g/mol |
| IUPAC name | 1-benzyl-3-(3-hydroxyphenyl)piperidine-2,6-dione |
| InChIKey | VDQYMEUOWOWQNG-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C(=O)C1C2=CC(=CC=C2)O)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)