Products 80997-87-1
CAS 80997-87-1 appears in our catalog under these names: 2-Amino-3-phenylbutanoic acid hydrochloride, 95%, 2–Amino–3–phenylbutanoic acid hydrochloride, 2-Amino-3-phenylbutanoic acid hydrochloride, beta-Methyl-DL-phenylalanine hydrochloride, 99%. Offered by: Combi-blocks, GLPBio, Biosynth, Thermo Scientific (Acros). Available pack sizes: 10g, 1g, 5g, 250mg, 100mg, 0,5g.
2-amino-3-phenylbutanoic acid;hydrochloride (CAS 80997-87-1) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: 2-amino-3-phenylbutanoic acid;hydrochloride. InChIKey: SGKWQBMDOXGYAA-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | 2-amino-3-phenylbutanoic acid;hydrochloride |
| InChIKey | SGKWQBMDOXGYAA-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC=C1)C(C(=O)O)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
2-amino-3-phenylbutanoic acid hydrochloride, 2-amino-3-phenylbutanoic acid;hydrochloride, (2S,3S)-2-Amino-3-phenyl-butyric acid hydrochloride, (2R,3R)-2-Amino-3-phenyl-butyric acid hydrochloride, beta-Methyl-3-phenyl-DL-alanine hydrochloride, L-Phenylalanine, b-methyl-, hydrochloride, threo-, L-Phenylalanine, b-methyl-, hydrochloride, erythro-, 2-amino-3-phenylbutanoic acid, chloride, beta-Methyl-3-phenyl-DL-alanine HCl, D-Phenylalanine, b-methyl-, hydrochloride, erythro-