Products 81017-73-4

CAS 81017-73-4 appears in our catalog under these names: 2–Amino–2–(3–hydroxyphenyl)acetic acid hydrochloride, 2-amino-2-(3-hydroxyphenyl)acetic acid hydrochloride, 2-Amino-2-(3-hydroxyphenyl)acetic acid hydrochloride, 97%, 97%, amino(3-hydroxyphenyl)acetic acid hydrochloride, 97%, H-DL-Phg(3-OH)-OH·HCl, 95%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 250mg, 5g, 0,5g, 50mg, 500mg, 2.5g.

Structural formula: {0} (CAS {1})

2-amino-2-(3-hydroxyphenyl)acetic acid;hydrochloride (CAS 81017-73-4) is a chemical compound with the molecular formula C8H10ClNO3 and a molecular weight of 203.62 g/mol. IUPAC name: 2-amino-2-(3-hydroxyphenyl)acetic acid;hydrochloride. InChIKey: KHWQGSMWKXKSAR-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10ClNO3
Molecular weight203.62 g/mol
IUPAC name2-amino-2-(3-hydroxyphenyl)acetic acid;hydrochloride
InChIKeyKHWQGSMWKXKSAR-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)O)C(C(=O)O)N.Cl

Computed by PubChem (NCBI)