Products 813461-21-1
CAS 813461-21-1 is the registry number for Cyclo(Tyr-hpro). Offered by: Biosynth, MedChemExpress. Available pack sizes: 25mg, 10mg, 50mg, 100mg, Get quote.
7-hydroxy-3-[(4-hydroxyphenyl)methyl]-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione (CAS 813461-21-1) is a chemical compound with the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. IUPAC name: 7-hydroxy-3-[(4-hydroxyphenyl)methyl]-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione. InChIKey: JEKJKMJDASOZRW-UHFFFAOYSA-N.
| Molecular formula | C14H16N2O4 |
|---|---|
| Molecular weight | 276.29 g/mol |
| IUPAC name | 7-hydroxy-3-[(4-hydroxyphenyl)methyl]-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
| InChIKey | JEKJKMJDASOZRW-UHFFFAOYSA-N |
| SMILES | C1C(CN2C1C(=O)NC(C2=O)CC3=CC=C(C=C3)O)O |
Computed by PubChem (NCBI)