Products 816449-15-7
CAS 816449-15-7 is the registry number for Indoline-1-Sulfonyl Chloride, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
2,3-dihydroindole-1-sulfonyl chloride (CAS 816449-15-7) is a chemical compound with the molecular formula C8H8ClNO2S and a molecular weight of 217.67 g/mol. IUPAC name: 2,3-dihydroindole-1-sulfonyl chloride. InChIKey: LVJKTCWWVQCGGY-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO2S |
|---|---|
| Molecular weight | 217.67 g/mol |
| IUPAC name | 2,3-dihydroindole-1-sulfonyl chloride |
| InChIKey | LVJKTCWWVQCGGY-UHFFFAOYSA-N |
| SMILES | C1CN(C2=CC=CC=C21)S(=O)(=O)Cl |
Computed by PubChem (NCBI)