CAS 816450-98-3 appears in our catalog under these names: 1-(3,4-Difluoro-2-hydroxyphenyl)ethan-1-one, 98%, 98%, 3',4'-Difluoro-2'-hydroxyacetophenone, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-(3,4-difluoro-2-hydroxyphenyl)ethanone (CAS 816450-98-3) is a chemical compound with the molecular formula C8H6F2O2 and a molecular weight of 172.13 g/mol. IUPAC name: 1-(3,4-difluoro-2-hydroxyphenyl)ethanone. InChIKey: NGHOATHDUMGWQN-UHFFFAOYSA-N.
| Molecular formula | C8H6F2O2 |
|---|---|
| Molecular weight | 172.13 g/mol |
| IUPAC name | 1-(3,4-difluoro-2-hydroxyphenyl)ethanone |
| InChIKey | NGHOATHDUMGWQN-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C(=C(C=C1)F)F)O |
Computed by PubChem (NCBI)