CAS 81945-10-0 appears in our catalog under these names: 4-Chloro-7-hydroxy-2,3-dihydroinden-1-one 95%, 4-Chloro-7-hydroxy-2,3-dihydroinden-1-one, 98%, 98%, 4-Chloro-7-hydroxy-2,3-dihydroinden-1-one, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g, 25g.
4-chloro-7-hydroxy-2,3-dihydroinden-1-one (CAS 81945-10-0) is a chemical compound with the molecular formula C9H7ClO2 and a molecular weight of 182.60 g/mol. IUPAC name: 4-chloro-7-hydroxy-2,3-dihydroinden-1-one. InChIKey: YVNMNVRDMWVUNR-UHFFFAOYSA-N.
| Molecular formula | C9H7ClO2 |
|---|---|
| Molecular weight | 182.60 g/mol |
| IUPAC name | 4-chloro-7-hydroxy-2,3-dihydroinden-1-one |
| InChIKey | YVNMNVRDMWVUNR-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C(C=CC(=C21)Cl)O |
Computed by PubChem (NCBI)