CAS 82649-18-1 is the registry number for 4-Amino-2,3-dihydro-1λâ¶,2-benzothiazole-1,1,3-trione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-amino-1,1-dioxo-1,2-benzothiazol-3-one (CAS 82649-18-1) is a chemical compound with the molecular formula C7H6N2O3S and a molecular weight of 198.20 g/mol. IUPAC name: 4-amino-1,1-dioxo-1,2-benzothiazol-3-one. InChIKey: JQSVXJNTPDVVKM-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O3S |
|---|---|
| Molecular weight | 198.20 g/mol |
| IUPAC name | 4-amino-1,1-dioxo-1,2-benzothiazol-3-one |
| InChIKey | JQSVXJNTPDVVKM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)S(=O)(=O)NC2=O)N |
Computed by PubChem (NCBI)