Products 82741-17-1
CAS 82741-17-1 appears in our catalog under these names: Adenosine-5',5''-d2, >95% (HPLC), Adenosine–d2, Adenosine-d2, 99.56%. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 10mM/1mL, 5 mg, 10 mg.
(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[dideuterio(hydroxy)methyl]oxolane-3,4-diol (CAS 82741-17-1) is a chemical compound with the molecular formula C10H13N5O4 and a molecular weight of 269.25 g/mol. IUPAC name: (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[dideuterio(hydroxy)methyl]oxolane-3,4-diol. InChIKey: OIRDTQYFTABQOQ-QTYQXZHASA-N.
| Molecular formula | C10H13N5O4 |
|---|---|
| Molecular weight | 269.25 g/mol |
| IUPAC name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[dideuterio(hydroxy)methyl]oxolane-3,4-diol |
| InChIKey | OIRDTQYFTABQOQ-QTYQXZHASA-N |
| SMILES | [2H]C([2H])([C@@H]1[C@H]([C@H]([C@@H](O1)N2C=NC3=C(N=CN=C32)N)O)O)O |
Computed by PubChem (NCBI)