Products 831207-32-0
CAS 831207-32-0 is the registry number for CK2-IN-10, 99.70%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 5 mg, 50 mg, 100 mg, 25 mg.
N-(2,4-dioxo-1H-pyrimidin-5-yl)-3,4-dimethylbenzamide (CAS 831207-32-0) is a chemical compound with the molecular formula C13H13N3O3 and a molecular weight of 259.26 g/mol. IUPAC name: N-(2,4-dioxo-1H-pyrimidin-5-yl)-3,4-dimethylbenzamide. InChIKey: RKCZDZMCIPPVEP-UHFFFAOYSA-N.
| Molecular formula | C13H13N3O3 |
|---|---|
| Molecular weight | 259.26 g/mol |
| IUPAC name | N-(2,4-dioxo-1H-pyrimidin-5-yl)-3,4-dimethylbenzamide |
| InChIKey | RKCZDZMCIPPVEP-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)NC2=CNC(=O)NC2=O)C |
Computed by PubChem (NCBI)