CAS 83509-88-0 appears in our catalog under these names: (S)-3-(((Benzyloxy)carbonyl)amino)butanoic acid, 97%, (S)–3–(((Benzyloxy)carbonyl)amino)butanoic acid, Cbz-HoAla-OH 97%, (S)-3-(((Benzyloxy)carbonyl)amino)butanoic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 10g, 5g, 250mg, 100mg, 50g, 100g.
(3S)-3-(phenylmethoxycarbonylamino)butanoic acid (CAS 83509-88-0) is a chemical compound with the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. IUPAC name: (3S)-3-(phenylmethoxycarbonylamino)butanoic acid. InChIKey: HYWJKPFAIAWVHP-VIFPVBQESA-N.
| Molecular formula | C12H15NO4 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | (3S)-3-(phenylmethoxycarbonylamino)butanoic acid |
| InChIKey | HYWJKPFAIAWVHP-VIFPVBQESA-N |
| SMILES | C[C@@H](CC(=O)O)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)