CAS 83548-61-2 is the registry number for 4-Chloro-2-methyl-5-phenylthieno(2,3-d)pyrimidine. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
4-chloro-2-methyl-5-phenylthieno[2,3-d]pyrimidine (CAS 83548-61-2) is a chemical compound with the molecular formula C13H9ClN2S and a molecular weight of 260.74 g/mol. IUPAC name: 4-chloro-2-methyl-5-phenylthieno[2,3-d]pyrimidine. InChIKey: MHSRBJIRDADQGQ-UHFFFAOYSA-N.
| Molecular formula | C13H9ClN2S |
|---|---|
| Molecular weight | 260.74 g/mol |
| IUPAC name | 4-chloro-2-methyl-5-phenylthieno[2,3-d]pyrimidine |
| InChIKey | MHSRBJIRDADQGQ-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C(=CS2)C3=CC=CC=C3)C(=N1)Cl |
Computed by PubChem (NCBI)