CAS 835903-13-4 appears in our catalog under these names: 5,7-Dichloroquinolin-2(1H)-one, 98%, 5,7-Dichloro-1,2-dihydroquinolin-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 10g, 1g, 100mg.
5,7-dichloro-1H-quinolin-2-one (CAS 835903-13-4) is a chemical compound with the molecular formula C9H5Cl2NO and a molecular weight of 214.04 g/mol. IUPAC name: 5,7-dichloro-1H-quinolin-2-one. InChIKey: POPQNDNLFIICBS-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2NO |
|---|---|
| Molecular weight | 214.04 g/mol |
| IUPAC name | 5,7-dichloro-1H-quinolin-2-one |
| InChIKey | POPQNDNLFIICBS-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)NC2=C1C(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)